C14H10Cl2N2O — CID 82357445
[2-(3,4-dichlorophenyl)-1,3-benzoxazol-6-yl]methanamine (PubChem CID 82357445) has the molecular formula C14H10Cl2N2O and a molecular weight of 293.15 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-1,3-benzoxazol-6-yl]methanamine.
| Compound Name | [2-(3,4-dichlorophenyl)-1,3-benzoxazol-6-yl]methanamine |
|---|---|
| PubChem CID | 82357445 |
| Molecular Formula | C14H10Cl2N2O |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-1,3-benzoxazol-6-yl]methanamine |
| SMILES | NCc1ccc2nc(-c3ccc(Cl)c(Cl)c3)oc2c1 |
| InChI | InChI=1S/C14H10Cl2N2O/c15-10-3-2-9(6-11(10)16)14-18-12-4-1-8(7-17)5-13(12)19-14/h1-6H,7,17H2 |
| InChIKey | OGNNMSRIEAUAKD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |