C14H11ClN2O — CID 81433640
[3-(7-chloro-1,3-benzoxazol-2-yl)phenyl]methanamine (PubChem CID 81433640) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is [3-(7-chloro-1,3-benzoxazol-2-yl)phenyl]methanamine.
| Compound Name | [3-(7-chloro-1,3-benzoxazol-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 81433640 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | [3-(7-chloro-1,3-benzoxazol-2-yl)phenyl]methanamine |
| SMILES | NCc1cccc(-c2nc3cccc(Cl)c3o2)c1 |
| InChI | InChI=1S/C14H11ClN2O/c15-11-5-2-6-12-13(11)18-14(17-12)10-4-1-3-9(7-10)8-16/h1-7H,8,16H2 |
| InChIKey | AOSHMIMKZSTBGE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |