C13H11ClN2OS — CID 81434294
3-(7-chloro-1,3-benzoxazol-2-yl)-5-ethylthiophen-2-amine (PubChem CID 81434294) has the molecular formula C13H11ClN2OS and a molecular weight of 278.76 g/mol. Its IUPAC name is 3-(7-chloro-1,3-benzoxazol-2-yl)-5-ethylthiophen-2-amine.
| Compound Name | 3-(7-chloro-1,3-benzoxazol-2-yl)-5-ethylthiophen-2-amine |
|---|---|
| PubChem CID | 81434294 |
| Molecular Formula | C13H11ClN2OS |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-(7-chloro-1,3-benzoxazol-2-yl)-5-ethylthiophen-2-amine |
| SMILES | CCc1cc(-c2nc3cccc(Cl)c3o2)c(N)s1 |
| InChI | InChI=1S/C13H11ClN2OS/c1-2-7-6-8(12(15)18-7)13-16-10-5-3-4-9(14)11(10)17-13/h3-6H,2,15H2,1H3 |
| InChIKey | BNEVKPPNWNQSSU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |