C20H14Cl2N2O — CID 50883317
4-(7-benzyl-1,3-benzoxazol-2-yl)-2,6-dichloroaniline (PubChem CID 50883317) has the molecular formula C20H14Cl2N2O and a molecular weight of 369.25 g/mol. Its IUPAC name is 4-(7-benzyl-1,3-benzoxazol-2-yl)-2,6-dichloroaniline.
| Compound Name | 4-(7-benzyl-1,3-benzoxazol-2-yl)-2,6-dichloroaniline |
|---|---|
| PubChem CID | 50883317 |
| Molecular Formula | C20H14Cl2N2O |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 4-(7-benzyl-1,3-benzoxazol-2-yl)-2,6-dichloroaniline |
| SMILES | Nc1c(Cl)cc(-c2nc3cccc(Cc4ccccc4)c3o2)cc1Cl |
| InChI | InChI=1S/C20H14Cl2N2O/c21-15-10-14(11-16(22)18(15)23)20-24-17-8-4-7-13(19(17)25-20)9-12-5-2-1-3-6-12/h1-8,10-11H,9,23H2 |
| InChIKey | NJZBEVQGIQLRFJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|