C15H14N2O3S — CID 81422815
[4-(5-methylsulfonyl-1,3-benzoxazol-2-yl)phenyl]methanamine (PubChem CID 81422815) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is [4-(5-methylsulfonyl-1,3-benzoxazol-2-yl)phenyl]methanamine.
| Compound Name | [4-(5-methylsulfonyl-1,3-benzoxazol-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 81422815 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | [4-(5-methylsulfonyl-1,3-benzoxazol-2-yl)phenyl]methanamine |
| SMILES | CS(=O)(=O)c1ccc2oc(-c3ccc(CN)cc3)nc2c1 |
| InChI | InChI=1S/C15H14N2O3S/c1-21(18,19)12-6-7-14-13(8-12)17-15(20-14)11-4-2-10(9-16)3-5-11/h2-8H,9,16H2,1H3 |
| InChIKey | VSYORHHOAKLHCU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |