C10H12N2O4S — CID 81433445
2-amino-1-(5-methylsulfonyl-1,3-benzoxazol-2-yl)ethanol (PubChem CID 81433445) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-amino-1-(5-methylsulfonyl-1,3-benzoxazol-2-yl)ethanol.
| Compound Name | 2-amino-1-(5-methylsulfonyl-1,3-benzoxazol-2-yl)ethanol |
|---|---|
| PubChem CID | 81433445 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-amino-1-(5-methylsulfonyl-1,3-benzoxazol-2-yl)ethanol |
| SMILES | CS(=O)(=O)c1ccc2oc(C(O)CN)nc2c1 |
| InChI | InChI=1S/C10H12N2O4S/c1-17(14,15)6-2-3-9-7(4-6)12-10(16-9)8(13)5-11/h2-4,8,13H,5,11H2,1H3 |
| InChIKey | XEIOGCNIFNBCNK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |