C12H13NO5S — CID 81434264
4-(5-methylsulfonyl-1,3-benzoxazol-2-yl)butanoic acid (PubChem CID 81434264) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is 4-(5-methylsulfonyl-1,3-benzoxazol-2-yl)butanoic acid.
| Compound Name | 4-(5-methylsulfonyl-1,3-benzoxazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 81434264 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-(5-methylsulfonyl-1,3-benzoxazol-2-yl)butanoic acid |
| SMILES | CS(=O)(=O)c1ccc2oc(CCCC(=O)O)nc2c1 |
| InChI | InChI=1S/C12H13NO5S/c1-19(16,17)8-5-6-10-9(7-8)13-11(18-10)3-2-4-12(14)15/h5-7H,2-4H2,1H3,(H,14,15) |
| InChIKey | LDMGLXRCNIOJFN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |