C13H18N2O3S — CID 81433352
N-[(5-methylsulfonyl-1,3-benzoxazol-2-yl)methyl]butan-2-amine (PubChem CID 81433352) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-[(5-methylsulfonyl-1,3-benzoxazol-2-yl)methyl]butan-2-amine.
| Compound Name | N-[(5-methylsulfonyl-1,3-benzoxazol-2-yl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 81433352 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-[(5-methylsulfonyl-1,3-benzoxazol-2-yl)methyl]butan-2-amine |
| SMILES | CCC(C)NCc1nc2cc(S(C)(=O)=O)ccc2o1 |
| InChI | InChI=1S/C13H18N2O3S/c1-4-9(2)14-8-13-15-11-7-10(19(3,16)17)5-6-12(11)18-13/h5-7,9,14H,4,8H2,1-3H3 |
| InChIKey | IDCSLGKKDBRGHN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |