C11H14N2O3S — CID 81434082
N-[(5-methylsulfonyl-1,3-benzoxazol-2-yl)methyl]ethanamine (PubChem CID 81434082) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-[(5-methylsulfonyl-1,3-benzoxazol-2-yl)methyl]ethanamine.
| Compound Name | N-[(5-methylsulfonyl-1,3-benzoxazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81434082 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-[(5-methylsulfonyl-1,3-benzoxazol-2-yl)methyl]ethanamine |
| SMILES | CCNCc1nc2cc(S(C)(=O)=O)ccc2o1 |
| InChI | InChI=1S/C11H14N2O3S/c1-3-12-7-11-13-9-6-8(17(2,14)15)4-5-10(9)16-11/h4-6,12H,3,7H2,1-2H3 |
| InChIKey | MLBVDNHYAIZSJK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |