C11H14N2O2 — CID 102696307
N-[(6-methoxy-1,3-benzoxazol-2-yl)methyl]ethanamine (PubChem CID 102696307) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-[(6-methoxy-1,3-benzoxazol-2-yl)methyl]ethanamine.
| Compound Name | N-[(6-methoxy-1,3-benzoxazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 102696307 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-[(6-methoxy-1,3-benzoxazol-2-yl)methyl]ethanamine |
| SMILES | CCNCc1nc2ccc(OC)cc2o1 |
| InChI | InChI=1S/C11H14N2O2/c1-3-12-7-11-13-9-5-4-8(14-2)6-10(9)15-11/h4-6,12H,3,7H2,1-2H3 |
| InChIKey | HVBWFRBDVFPWSP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |