C9H9NO3 — CID 130837155
(6-methoxy-1,3-benzoxazol-2-yl)methanol (PubChem CID 130837155) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is (6-methoxy-1,3-benzoxazol-2-yl)methanol.
| Compound Name | (6-methoxy-1,3-benzoxazol-2-yl)methanol |
|---|---|
| PubChem CID | 130837155 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (6-methoxy-1,3-benzoxazol-2-yl)methanol |
| SMILES | COc1ccc2nc(CO)oc2c1 |
| InChI | InChI=1S/C9H9NO3/c1-12-6-2-3-7-8(4-6)13-9(5-11)10-7/h2-4,11H,5H2,1H3 |
| InChIKey | NNUWSCWEFZWLEV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |