About 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol
2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol (PubChem CID 146454064) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol |
| PubChem CID | 146454064 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol |
| SMILES | COc1ccc2nc(NCCO)oc2c1 |
| InChI | InChI=1S/C10H12N2O3/c1-14-7-2-3-8-9(6-7)15-10(12-8)11-4-5-13/h2-3,6,13H,4-5H2,1H3,(H,11,12) |
| InChIKey | OIFSNERDZQTRFE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol?
The IUPAC name of 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol (CID 146454064) is 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol.
What is the SMILES notation for 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol?
The canonical SMILES for 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol is COc1ccc2nc(NCCO)oc2c1.
What is the InChIKey of 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol?
The InChIKey is OIFSNERDZQTRFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3/c1-14-7-2-3-8-9(6-7)15-10(12-8)11-4-5-13/h2-3,6,13H,4-5H2,1H3,(H,11,12).
What are the key properties of 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol?
2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol has a molecular weight of 208.22 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol is sourced from PubChem (CID 146454064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).