C10H12N2O3 — CID 146454064
2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol (PubChem CID 146454064) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol.
| Compound Name | 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 146454064 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-[(6-methoxy-1,3-benzoxazol-2-yl)amino]ethanol |
| SMILES | COc1ccc2nc(NCCO)oc2c1 |
| InChI | InChI=1S/C10H12N2O3/c1-14-7-2-3-8-9(6-7)15-10(12-8)11-4-5-13/h2-3,6,13H,4-5H2,1H3,(H,11,12) |
| InChIKey | OIFSNERDZQTRFE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |