C11H14N2O3 — CID 107837480
3-amino-1-(6-methoxy-1,3-benzoxazol-2-yl)propan-1-ol (PubChem CID 107837480) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-amino-1-(6-methoxy-1,3-benzoxazol-2-yl)propan-1-ol.
| Compound Name | 3-amino-1-(6-methoxy-1,3-benzoxazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 107837480 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-amino-1-(6-methoxy-1,3-benzoxazol-2-yl)propan-1-ol |
| SMILES | COc1ccc2nc(C(O)CCN)oc2c1 |
| InChI | InChI=1S/C11H14N2O3/c1-15-7-2-3-8-10(6-7)16-11(13-8)9(14)4-5-12/h2-3,6,9,14H,4-5,12H2,1H3 |
| InChIKey | OIXQYELAWXUKGH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |