C10H11ClN2O2 — CID 107837473
3-amino-1-(6-chloro-1,3-benzoxazol-2-yl)propan-1-ol (PubChem CID 107837473) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 3-amino-1-(6-chloro-1,3-benzoxazol-2-yl)propan-1-ol.
| Compound Name | 3-amino-1-(6-chloro-1,3-benzoxazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 107837473 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 3-amino-1-(6-chloro-1,3-benzoxazol-2-yl)propan-1-ol |
| SMILES | NCCC(O)c1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C10H11ClN2O2/c11-6-1-2-7-9(5-6)15-10(13-7)8(14)3-4-12/h1-2,5,8,14H,3-4,12H2 |
| InChIKey | OXPOIUOELVZGGX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |