C12H14ClNO — CID 175910194
6-chloro-2-pentan-3-yl-1,3-benzoxazole (PubChem CID 175910194) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is 6-chloro-2-pentan-3-yl-1,3-benzoxazole.
| Compound Name | 6-chloro-2-pentan-3-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 175910194 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 6-chloro-2-pentan-3-yl-1,3-benzoxazole |
| SMILES | CCC(CC)c1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C12H14ClNO/c1-3-8(4-2)12-14-10-6-5-9(13)7-11(10)15-12/h5-8H,3-4H2,1-2H3 |
| InChIKey | JLQHSGNHQFWWEH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |