C14H19NO — CID 71228130
2-heptan-4-yl-1,3-benzoxazole (PubChem CID 71228130) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-heptan-4-yl-1,3-benzoxazole.
| Compound Name | 2-heptan-4-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 71228130 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-heptan-4-yl-1,3-benzoxazole |
| SMILES | CCCC(CCC)c1nc2ccccc2o1 |
| InChI | InChI=1S/C14H19NO/c1-3-7-11(8-4-2)14-15-12-9-5-6-10-13(12)16-14/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | PTPQQKNCHREXKB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |