C11H14N2O2 — CID 11665617
(2S)-2-amino-1-(1,3-benzoxazol-2-yl)butan-1-ol (PubChem CID 11665617) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2S)-2-amino-1-(1,3-benzoxazol-2-yl)butan-1-ol.
| Compound Name | (2S)-2-amino-1-(1,3-benzoxazol-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 11665617 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (2S)-2-amino-1-(1,3-benzoxazol-2-yl)butan-1-ol |
| SMILES | CC[C@H](N)C(O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C11H14N2O2/c1-2-7(12)10(14)11-13-8-5-3-4-6-9(8)15-11/h3-7,10,14H,2,12H2,1H3/t7-,10?/m0/s1 |
| InChIKey | MZEKOAKWBBNMBO-BYDSUWOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |