C12H14N2O2 — CID 58458983
(2S)-2-amino-1-(1,3-benzoxazol-2-yl)-2-cyclopropylethanol (PubChem CID 58458983) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (2S)-2-amino-1-(1,3-benzoxazol-2-yl)-2-cyclopropylethanol.
| Compound Name | (2S)-2-amino-1-(1,3-benzoxazol-2-yl)-2-cyclopropylethanol |
|---|---|
| PubChem CID | 58458983 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (2S)-2-amino-1-(1,3-benzoxazol-2-yl)-2-cyclopropylethanol |
| SMILES | N[C@@H](C1CC1)C(O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C12H14N2O2/c13-10(7-5-6-7)11(15)12-14-8-3-1-2-4-9(8)16-12/h1-4,7,10-11,15H,5-6,13H2/t10-,11?/m0/s1 |
| InChIKey | ICDDNDLZWMFYSF-VUWPPUDQSA-N |
| XLogP | 1.60 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |