C12H16N2O2 — CID 59918149
(2S)-2-amino-1-(1,3-benzoxazol-2-yl)pentan-1-ol (PubChem CID 59918149) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2S)-2-amino-1-(1,3-benzoxazol-2-yl)pentan-1-ol.
| Compound Name | (2S)-2-amino-1-(1,3-benzoxazol-2-yl)pentan-1-ol |
|---|---|
| PubChem CID | 59918149 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2S)-2-amino-1-(1,3-benzoxazol-2-yl)pentan-1-ol |
| SMILES | CCC[C@H](N)C(O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-5-8(13)11(15)12-14-9-6-3-4-7-10(9)16-12/h3-4,6-8,11,15H,2,5,13H2,1H3/t8-,11?/m0/s1 |
| InChIKey | DYFLWZLTQLEOIZ-YMNIQAILSA-N |
| XLogP | 1.99 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |