C15H14N2O2 — CID 174575331
2-[2-amino-2-(1,3-benzoxazol-2-yl)ethyl]phenol (PubChem CID 174575331) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[2-amino-2-(1,3-benzoxazol-2-yl)ethyl]phenol.
| Compound Name | 2-[2-amino-2-(1,3-benzoxazol-2-yl)ethyl]phenol |
|---|---|
| PubChem CID | 174575331 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[2-amino-2-(1,3-benzoxazol-2-yl)ethyl]phenol |
| SMILES | NC(Cc1ccccc1O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C15H14N2O2/c16-11(9-10-5-1-3-7-13(10)18)15-17-12-6-2-4-8-14(12)19-15/h1-8,11,18H,9,16H2 |
| InChIKey | VFNSHSKUGXAWIZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |