C13H19N3O4S — CID 173413342
3-(1,3-benzoxazol-2-yl)-4-oxo-4-sulfanylbutanoic acid;methanamine (PubChem CID 173413342) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-4-oxo-4-sulfanylbutanoic acid;methanamine.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-4-oxo-4-sulfanylbutanoic acid;methanamine |
|---|---|
| PubChem CID | 173413342 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-4-oxo-4-sulfanylbutanoic acid;methanamine |
| SMILES | CN.CN.O=C(O)CC(C(=O)S)c1nc2ccccc2o1 |
| InChI | InChI=1S/C11H9NO4S.2CH5N/c13-9(14)5-6(11(15)17)10-12-7-3-1-2-4-8(7)16-10;2*1-2/h1-4,6H,5H2,(H,13,14)(H,15,17);2*2H2,1H3 |
| InChIKey | FGSFTNQGUFHAGT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|