C12H11N3O3S — CID 57257595
3-(1,3-benzoxazol-2-yl)-2-sulfanylidenepentanediamide (PubChem CID 57257595) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-2-sulfanylidenepentanediamide.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-2-sulfanylidenepentanediamide |
|---|---|
| PubChem CID | 57257595 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-2-sulfanylidenepentanediamide |
| SMILES | NC(=O)CC(C(=S)C(N)=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C12H11N3O3S/c13-9(16)5-6(10(19)11(14)17)12-15-7-3-1-2-4-8(7)18-12/h1-4,6H,5H2,(H2,13,16)(H2,14,17) |
| InChIKey | VAMPPSZFRSNQGW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|