C11H7NO3S2Zn — CID 88687444
zinc 2-(1,3-benzoxazol-2-yl)butanebis(thioate) (PubChem CID 88687444) has the molecular formula C11H7NO3S2Zn and a molecular weight of 330.71 g/mol. Its IUPAC name is zinc 2-(1,3-benzoxazol-2-yl)butanebis(thioate).
| Compound Name | zinc 2-(1,3-benzoxazol-2-yl)butanebis(thioate) |
|---|---|
| PubChem CID | 88687444 |
| Molecular Formula | C11H7NO3S2Zn |
| Molecular Weight | 330.71 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | zinc 2-(1,3-benzoxazol-2-yl)butanebis(thioate) |
| SMILES | O=C([S-])CC(C(=O)[S-])c1nc2ccccc2o1.[Zn+2] |
| InChI | InChI=1S/C11H9NO3S2.Zn/c13-9(16)5-6(11(14)17)10-12-7-3-1-2-4-8(7)15-10;/h1-4,6H,5H2,(H,13,16)(H,14,17);/q;+2/p-2 |
| InChIKey | NDYCMFKCAPGOQH-UHFFFAOYSA-L |
| XLogP | 1.45 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.71 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|