C15H20N2O2 — CID 110278975
N-[1-(1,3-benzoxazol-2-yl)ethyl]-2,2-dimethylbutanamide (PubChem CID 110278975) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-[1-(1,3-benzoxazol-2-yl)ethyl]-2,2-dimethylbutanamide.
| Compound Name | N-[1-(1,3-benzoxazol-2-yl)ethyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 110278975 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-[1-(1,3-benzoxazol-2-yl)ethyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)NC(C)c1nc2ccccc2o1 |
| InChI | InChI=1S/C15H20N2O2/c1-5-15(3,4)14(18)16-10(2)13-17-11-8-6-7-9-12(11)19-13/h6-10H,5H2,1-4H3,(H,16,18) |
| InChIKey | WNYACFKXCQFLER-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |