C17H24N2O2 — CID 110278925
N-[1-(1,3-benzoxazol-2-yl)ethyl]-2-ethylhexanamide (PubChem CID 110278925) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[1-(1,3-benzoxazol-2-yl)ethyl]-2-ethylhexanamide.
| Compound Name | N-[1-(1,3-benzoxazol-2-yl)ethyl]-2-ethylhexanamide |
|---|---|
| PubChem CID | 110278925 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-[1-(1,3-benzoxazol-2-yl)ethyl]-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)NC(C)c1nc2ccccc2o1 |
| InChI | InChI=1S/C17H24N2O2/c1-4-6-9-13(5-2)16(20)18-12(3)17-19-14-10-7-8-11-15(14)21-17/h7-8,10-13H,4-6,9H2,1-3H3,(H,18,20) |
| InChIKey | IDLIBELWYAXUKV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |