C12H15NO2 — CID 116999943
2-(1,3-benzoxazol-2-yl)-3-methylbutan-1-ol (PubChem CID 116999943) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-3-methylbutan-1-ol.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 116999943 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-3-methylbutan-1-ol |
| SMILES | CC(C)C(CO)c1nc2ccccc2o1 |
| InChI | InChI=1S/C12H15NO2/c1-8(2)9(7-14)12-13-10-5-3-4-6-11(10)15-12/h3-6,8-9,14H,7H2,1-2H3 |
| InChIKey | OUNZYKLQJGWZSJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |