C14H23NOSi2 — CID 58835908
[1,3-benzoxazol-2-yl(trimethylsilyl)methyl]-trimethylsilane (PubChem CID 58835908) has the molecular formula C14H23NOSi2 and a molecular weight of 277.52 g/mol. Its IUPAC name is [1,3-benzoxazol-2-yl(trimethylsilyl)methyl]-trimethylsilane.
| Compound Name | [1,3-benzoxazol-2-yl(trimethylsilyl)methyl]-trimethylsilane |
|---|---|
| PubChem CID | 58835908 |
| Molecular Formula | C14H23NOSi2 |
| Molecular Weight | 277.52 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [1,3-benzoxazol-2-yl(trimethylsilyl)methyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(c1nc2ccccc2o1)[Si](C)(C)C |
| InChI | InChI=1S/C14H23NOSi2/c1-17(2,3)14(18(4,5)6)13-15-11-9-7-8-10-12(11)16-13/h7-10,14H,1-6H3 |
| InChIKey | KXYFYRUKLYZWHV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|