C15H16N2O3 — CID 167676183
2-aminophenol;1-(1,3-benzoxazol-2-yl)ethanol (PubChem CID 167676183) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-aminophenol;1-(1,3-benzoxazol-2-yl)ethanol.
| Compound Name | 2-aminophenol;1-(1,3-benzoxazol-2-yl)ethanol |
|---|---|
| PubChem CID | 167676183 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-aminophenol;1-(1,3-benzoxazol-2-yl)ethanol |
| SMILES | CC(O)c1nc2ccccc2o1.Nc1ccccc1O |
| InChI | InChI=1S/C9H9NO2.C6H7NO/c1-6(11)9-10-7-4-2-3-5-8(7)12-9;7-5-3-1-2-4-6(5)8/h2-6,11H,1H3;1-4,8H,7H2 |
| InChIKey | UVOSPUUHKIYIGO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|