C10H9AcNO3 — CID 59122433
actinium;2-[(1R)-1-hydroxyethyl]-3,1-benzoxazin-4-one (PubChem CID 59122433) has the molecular formula C10H9AcNO3 and a molecular weight of 418.19 g/mol. Its IUPAC name is actinium;2-[(1R)-1-hydroxyethyl]-3,1-benzoxazin-4-one.
| Compound Name | actinium;2-[(1R)-1-hydroxyethyl]-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 59122433 |
| Molecular Formula | C10H9AcNO3 |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | actinium;2-[(1R)-1-hydroxyethyl]-3,1-benzoxazin-4-one |
| SMILES | C[C@@H](O)c1nc2ccccc2c(=O)o1.[Ac] |
| InChI | InChI=1S/C10H9NO3.Ac/c1-6(12)9-11-8-5-3-2-4-7(8)10(13)14-9;/h2-6,12H,1H3;/t6-;/m1./s1 |
| InChIKey | PXTWWEYAVNUQDH-FYZOBXCZSA-N |
| XLogP | 1.24 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |