C24H20N2O4 — CID 100978788
benzyl N-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethyl]carbamate (PubChem CID 100978788) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is benzyl N-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethyl]carbamate.
| Compound Name | benzyl N-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 100978788 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | benzyl N-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethyl]carbamate |
| SMILES | O=C(NC(Cc1ccccc1)c1nc2ccccc2c(=O)o1)OCc1ccccc1 |
| InChI | InChI=1S/C24H20N2O4/c27-23-19-13-7-8-14-20(19)25-22(30-23)21(15-17-9-3-1-4-10-17)26-24(28)29-16-18-11-5-2-6-12-18/h1-14,21H,15-16H2,(H,26,28) |
| InChIKey | AWJQPEQWTKTXFB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |