C25H21N3O4 — CID 59013250
benzyl N-[(2S)-1-(1,3-benzoxazol-2-yl)-1-hydroxy-3-(4-isocyanophenyl)propan-2-yl]carbamate (PubChem CID 59013250) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(1,3-benzoxazol-2-yl)-1-hydroxy-3-(4-isocyanophenyl)propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(1,3-benzoxazol-2-yl)-1-hydroxy-3-(4-isocyanophenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 59013250 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | benzyl N-[(2S)-1-(1,3-benzoxazol-2-yl)-1-hydroxy-3-(4-isocyanophenyl)propan-2-yl]carbamate |
| SMILES | [C-]#[N+]c1ccc(C[C@H](NC(=O)OCc2ccccc2)C(O)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C25H21N3O4/c1-26-19-13-11-17(12-14-19)15-21(28-25(30)31-16-18-7-3-2-4-8-18)23(29)24-27-20-9-5-6-10-22(20)32-24/h2-14,21,23,29H,15-16H2,(H,28,30)/t21-,23?/m0/s1 |
| InChIKey | OZKBBXFUMHKVFE-BBQAJUCSSA-N |
| XLogP | 4.95 |
| TPSA | 88.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|