3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid

C11H12N2O4 — CID 66853727

IUPAC3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid
SMILESNC(CC(=O)O)C(O)c1nc2ccccc2o1
InChIInChI=1S/C11H12N2O4/c12-6(5-9(14)15)10(16)11-13-7-3-1-2-4-8(7)17-11/h1-4,6,10,16H,5,12H2,(H,14,15)
InChIKeyLJXISEGJEDQHQW-UHFFFAOYSA-N
MW236.23 g/mol
LogP0.66
Rot. Bonds4

About 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid

3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid (PubChem CID 66853727) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid.

Molecular Properties

Compound Name3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid
PubChem CID66853727
Molecular FormulaC11H12N2O4
Molecular Weight236.23 g/mol
Exact Mass236.08
IUPAC Name3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid
SMILESNC(CC(=O)O)C(O)c1nc2ccccc2o1
InChIInChI=1S/C11H12N2O4/c12-6(5-9(14)15)10(16)11-13-7-3-1-2-4-8(7)17-11/h1-4,6,10,16H,5,12H2,(H,14,15)
InChIKeyLJXISEGJEDQHQW-UHFFFAOYSA-N
XLogP0.66
TPSA109.58 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.23
LogP ≤ 50.66
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid?
The IUPAC name of 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid (CID 66853727) is 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid.
What is the SMILES notation for 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid?
The canonical SMILES for 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid is NC(CC(=O)O)C(O)c1nc2ccccc2o1.
What is the InChIKey of 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid?
The InChIKey is LJXISEGJEDQHQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4/c12-6(5-9(14)15)10(16)11-13-7-3-1-2-4-8(7)17-11/h1-4,6,10,16H,5,12H2,(H,14,15).
What are the key properties of 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid?
3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid has a molecular weight of 236.23 g/mol, XLogP of 0.66, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-(1,3-benzoxazol-2-yl)-4-hydroxybutanoic acid is sourced from PubChem (CID 66853727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).