C27H24N2O3 — CID 54377108
benzyl N-[(1R)-1-(4,5-diphenyl-1,3-oxazol-2-yl)but-3-enyl]carbamate (PubChem CID 54377108) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is benzyl N-[(1R)-1-(4,5-diphenyl-1,3-oxazol-2-yl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[(1R)-1-(4,5-diphenyl-1,3-oxazol-2-yl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 54377108 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | benzyl N-[(1R)-1-(4,5-diphenyl-1,3-oxazol-2-yl)but-3-enyl]carbamate |
| SMILES | C=CC[C@@H](NC(=O)OCc1ccccc1)c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C27H24N2O3/c1-2-12-23(28-27(30)31-19-20-13-6-3-7-14-20)26-29-24(21-15-8-4-9-16-21)25(32-26)22-17-10-5-11-18-22/h2-11,13-18,23H,1,12,19H2,(H,28,30)/t23-/m1/s1 |
| InChIKey | UXHJYBFYSMKTGZ-HSZRJFAPSA-N |
| XLogP | 6.55 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|