About 2-propyl-3,1-benzoxazin-4-one
2-propyl-3,1-benzoxazin-4-one (PubChem CID 823661) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-propyl-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-propyl-3,1-benzoxazin-4-one |
| PubChem CID | 823661 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-propyl-3,1-benzoxazin-4-one |
| SMILES | CCCc1nc2ccccc2c(=O)o1 |
| InChI | InChI=1S/C11H11NO2/c1-2-5-10-12-9-7-4-3-6-8(9)11(13)14-10/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | UXLGTGPMUITKPA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-3,1-benzoxazin-4-one?
The IUPAC name of 2-propyl-3,1-benzoxazin-4-one (CID 823661) is 2-propyl-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-propyl-3,1-benzoxazin-4-one?
The canonical SMILES for 2-propyl-3,1-benzoxazin-4-one is CCCc1nc2ccccc2c(=O)o1.
What is the InChIKey of 2-propyl-3,1-benzoxazin-4-one?
The InChIKey is UXLGTGPMUITKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-2-5-10-12-9-7-4-3-6-8(9)11(13)14-10/h3-4,6-7H,2,5H2,1H3.
What are the key properties of 2-propyl-3,1-benzoxazin-4-one?
2-propyl-3,1-benzoxazin-4-one has a molecular weight of 189.21 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-3,1-benzoxazin-4-one is sourced from PubChem (CID 823661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).