About cyclohexyl 2-aminobenzoate
cyclohexyl 2-aminobenzoate (PubChem CID 24510) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is cyclohexyl 2-aminobenzoate.
Molecular Properties
| Compound Name | cyclohexyl 2-aminobenzoate |
| PubChem CID | 24510 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | cyclohexyl 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C13H17NO2/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7,14H2 |
| InChIKey | KFEZETDKFSMLMG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-aminobenzoate?
The IUPAC name of cyclohexyl 2-aminobenzoate (CID 24510) is cyclohexyl 2-aminobenzoate.
What is the SMILES notation for cyclohexyl 2-aminobenzoate?
The canonical SMILES for cyclohexyl 2-aminobenzoate is Nc1ccccc1C(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 2-aminobenzoate?
The InChIKey is KFEZETDKFSMLMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7,14H2.
What are the key properties of cyclohexyl 2-aminobenzoate?
cyclohexyl 2-aminobenzoate has a molecular weight of 219.28 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-aminobenzoate is sourced from PubChem (CID 24510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).