About cyclohexyl 2-formyloxybenzoate
cyclohexyl 2-formyloxybenzoate (PubChem CID 54103583) has the molecular formula C14H16O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is cyclohexyl 2-formyloxybenzoate.
Molecular Properties
| Compound Name | cyclohexyl 2-formyloxybenzoate |
| PubChem CID | 54103583 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | cyclohexyl 2-formyloxybenzoate |
| SMILES | O=COc1ccccc1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C14H16O4/c15-10-17-13-9-5-4-8-12(13)14(16)18-11-6-2-1-3-7-11/h4-5,8-11H,1-3,6-7H2 |
| InChIKey | VBGWXMBDELOCHN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 2-formyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-formyloxybenzoate?
The IUPAC name of cyclohexyl 2-formyloxybenzoate (CID 54103583) is cyclohexyl 2-formyloxybenzoate.
What is the SMILES notation for cyclohexyl 2-formyloxybenzoate?
The canonical SMILES for cyclohexyl 2-formyloxybenzoate is O=COc1ccccc1C(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 2-formyloxybenzoate?
The InChIKey is VBGWXMBDELOCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4/c15-10-17-13-9-5-4-8-12(13)14(16)18-11-6-2-1-3-7-11/h4-5,8-11H,1-3,6-7H2.
What are the key properties of cyclohexyl 2-formyloxybenzoate?
cyclohexyl 2-formyloxybenzoate has a molecular weight of 248.28 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-formyloxybenzoate is sourced from PubChem (CID 54103583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).