About cyclobutyl 2-amino-3-bromobenzoate
cyclobutyl 2-amino-3-bromobenzoate (PubChem CID 63113137) has the molecular formula C11H12BrNO2
and a molecular weight of 270.13 g/mol. Its IUPAC name is cyclobutyl 2-amino-3-bromobenzoate.
Molecular Properties
| Compound Name | cyclobutyl 2-amino-3-bromobenzoate |
| PubChem CID | 63113137 |
| Molecular Formula | C11H12BrNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | cyclobutyl 2-amino-3-bromobenzoate |
| SMILES | Nc1c(Br)cccc1C(=O)OC1CCC1 |
| InChI | InChI=1S/C11H12BrNO2/c12-9-6-2-5-8(10(9)13)11(14)15-7-3-1-4-7/h2,5-7H,1,3-4,13H2 |
| InChIKey | NFLXQQMXQHZWEN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclobutyl 2-amino-3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl 2-amino-3-bromobenzoate?
The IUPAC name of cyclobutyl 2-amino-3-bromobenzoate (CID 63113137) is cyclobutyl 2-amino-3-bromobenzoate.
What is the SMILES notation for cyclobutyl 2-amino-3-bromobenzoate?
The canonical SMILES for cyclobutyl 2-amino-3-bromobenzoate is Nc1c(Br)cccc1C(=O)OC1CCC1.
What is the InChIKey of cyclobutyl 2-amino-3-bromobenzoate?
The InChIKey is NFLXQQMXQHZWEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrNO2/c12-9-6-2-5-8(10(9)13)11(14)15-7-3-1-4-7/h2,5-7H,1,3-4,13H2.
What are the key properties of cyclobutyl 2-amino-3-bromobenzoate?
cyclobutyl 2-amino-3-bromobenzoate has a molecular weight of 270.13 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl 2-amino-3-bromobenzoate is sourced from PubChem (CID 63113137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).