About (3-methylcyclohexyl) 2-amino-3-bromobenzoate
(3-methylcyclohexyl) 2-amino-3-bromobenzoate (PubChem CID 55225158) has the molecular formula C14H18BrNO2
and a molecular weight of 312.21 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2-amino-3-bromobenzoate.
Molecular Properties
| Compound Name | (3-methylcyclohexyl) 2-amino-3-bromobenzoate |
| PubChem CID | 55225158 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (3-methylcyclohexyl) 2-amino-3-bromobenzoate |
| SMILES | CC1CCCC(OC(=O)c2cccc(Br)c2N)C1 |
| InChI | InChI=1S/C14H18BrNO2/c1-9-4-2-5-10(8-9)18-14(17)11-6-3-7-12(15)13(11)16/h3,6-7,9-10H,2,4-5,8,16H2,1H3 |
| InChIKey | FXXDDOPRPLYYQL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-methylcyclohexyl) 2-amino-3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl) 2-amino-3-bromobenzoate?
The IUPAC name of (3-methylcyclohexyl) 2-amino-3-bromobenzoate (CID 55225158) is (3-methylcyclohexyl) 2-amino-3-bromobenzoate.
What is the SMILES notation for (3-methylcyclohexyl) 2-amino-3-bromobenzoate?
The canonical SMILES for (3-methylcyclohexyl) 2-amino-3-bromobenzoate is CC1CCCC(OC(=O)c2cccc(Br)c2N)C1.
What is the InChIKey of (3-methylcyclohexyl) 2-amino-3-bromobenzoate?
The InChIKey is FXXDDOPRPLYYQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrNO2/c1-9-4-2-5-10(8-9)18-14(17)11-6-3-7-12(15)13(11)16/h3,6-7,9-10H,2,4-5,8,16H2,1H3.
What are the key properties of (3-methylcyclohexyl) 2-amino-3-bromobenzoate?
(3-methylcyclohexyl) 2-amino-3-bromobenzoate has a molecular weight of 312.21 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 2-amino-3-bromobenzoate is sourced from PubChem (CID 55225158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).