About (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate
(3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate (PubChem CID 103297829) has the molecular formula C15H20FNO2
and a molecular weight of 265.33 g/mol. Its IUPAC name is (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate.
Molecular Properties
| Compound Name | (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate |
| PubChem CID | 103297829 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate |
| SMILES | Cc1cc(N)cc(C(=O)OC2CCCC(C)C2)c1F |
| InChI | InChI=1S/C15H20FNO2/c1-9-4-3-5-12(6-9)19-15(18)13-8-11(17)7-10(2)14(13)16/h7-9,12H,3-6,17H2,1-2H3 |
| InChIKey | HIMOBOAFZNRIKY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate?
The IUPAC name of (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate (CID 103297829) is (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate.
What is the SMILES notation for (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate?
The canonical SMILES for (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate is Cc1cc(N)cc(C(=O)OC2CCCC(C)C2)c1F.
What is the InChIKey of (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate?
The InChIKey is HIMOBOAFZNRIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO2/c1-9-4-3-5-12(6-9)19-15(18)13-8-11(17)7-10(2)14(13)16/h7-9,12H,3-6,17H2,1-2H3.
What are the key properties of (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate?
(3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate has a molecular weight of 265.33 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 5-amino-2-fluoro-3-methylbenzoate is sourced from PubChem (CID 103297829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).