C16H20FNO2 — CID 103297866
2-bicyclo[2.2.1]heptanylmethyl 5-amino-2-fluoro-3-methylbenzoate (PubChem CID 103297866) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanylmethyl 5-amino-2-fluoro-3-methylbenzoate.
| Compound Name | 2-bicyclo[2.2.1]heptanylmethyl 5-amino-2-fluoro-3-methylbenzoate |
|---|---|
| PubChem CID | 103297866 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanylmethyl 5-amino-2-fluoro-3-methylbenzoate |
| SMILES | Cc1cc(N)cc(C(=O)OCC2CC3CCC2C3)c1F |
| InChI | InChI=1S/C16H20FNO2/c1-9-4-13(18)7-14(15(9)17)16(19)20-8-12-6-10-2-3-11(12)5-10/h4,7,10-12H,2-3,5-6,8,18H2,1H3 |
| InChIKey | BIPVRCHPJJAXFO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|