C17H22O4 — CID 110190393
2-bicyclo[2.2.1]heptanylmethyl 2,6-dimethoxybenzoate (PubChem CID 110190393) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanylmethyl 2,6-dimethoxybenzoate.
| Compound Name | 2-bicyclo[2.2.1]heptanylmethyl 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 110190393 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanylmethyl 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OCC1CC2CCC1C2 |
| InChI | InChI=1S/C17H22O4/c1-19-14-4-3-5-15(20-2)16(14)17(18)21-10-13-9-11-6-7-12(13)8-11/h3-5,11-13H,6-10H2,1-2H3 |
| InChIKey | JBXWGFQVZPRETN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |