C15H19NO2 — CID 98115390
[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]methyl N-phenylcarbamate (PubChem CID 98115390) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]methyl N-phenylcarbamate.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]methyl N-phenylcarbamate |
|---|---|
| PubChem CID | 98115390 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]methyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OC[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C15H19NO2/c17-15(16-14-4-2-1-3-5-14)18-10-13-9-11-6-7-12(13)8-11/h1-5,11-13H,6-10H2,(H,16,17)/t11-,12-,13-/m1/s1 |
| InChIKey | ZHGKSZKATLNNMK-JHJVBQTASA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |