C13H19N3O2 — CID 12650344
(1,2-dimethylpyrazolidin-3-yl)methyl N-phenylcarbamate (PubChem CID 12650344) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is (1,2-dimethylpyrazolidin-3-yl)methyl N-phenylcarbamate.
| Compound Name | (1,2-dimethylpyrazolidin-3-yl)methyl N-phenylcarbamate |
|---|---|
| PubChem CID | 12650344 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (1,2-dimethylpyrazolidin-3-yl)methyl N-phenylcarbamate |
| SMILES | CN1CCC(COC(=O)Nc2ccccc2)N1C |
| InChI | InChI=1S/C13H19N3O2/c1-15-9-8-12(16(15)2)10-18-13(17)14-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,14,17) |
| InChIKey | MWAWFAUYBBLXFD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |