C16H21NO3 — CID 104784089
2-bicyclo[2.2.1]heptanylmethyl 4-amino-2-methoxybenzoate (PubChem CID 104784089) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanylmethyl 4-amino-2-methoxybenzoate.
| Compound Name | 2-bicyclo[2.2.1]heptanylmethyl 4-amino-2-methoxybenzoate |
|---|---|
| PubChem CID | 104784089 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanylmethyl 4-amino-2-methoxybenzoate |
| SMILES | COc1cc(N)ccc1C(=O)OCC1CC2CCC1C2 |
| InChI | InChI=1S/C16H21NO3/c1-19-15-8-13(17)4-5-14(15)16(18)20-9-12-7-10-2-3-11(12)6-10/h4-5,8,10-12H,2-3,6-7,9,17H2,1H3 |
| InChIKey | IESCTIRMDUTDPK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|