C15H17FO3 — CID 107014523
2-(2-bicyclo[2.2.1]heptanylmethoxy)-4-fluorobenzoic acid (PubChem CID 107014523) has the molecular formula C15H17FO3 and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethoxy)-4-fluorobenzoic acid.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethoxy)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 107014523 |
| Molecular Formula | C15H17FO3 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethoxy)-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)cc1OCC1CC2CCC1C2 |
| InChI | InChI=1S/C15H17FO3/c16-12-3-4-13(15(17)18)14(7-12)19-8-11-6-9-1-2-10(11)5-9/h3-4,7,9-11H,1-2,5-6,8H2,(H,17,18) |
| InChIKey | CETNAVGHSMQPLE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |