C15H19FN2O — CID 63682899
2-amino-N-(2-bicyclo[2.2.1]heptanylmethyl)-4-fluorobenzamide (PubChem CID 63682899) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-amino-N-(2-bicyclo[2.2.1]heptanylmethyl)-4-fluorobenzamide.
| Compound Name | 2-amino-N-(2-bicyclo[2.2.1]heptanylmethyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 63682899 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-amino-N-(2-bicyclo[2.2.1]heptanylmethyl)-4-fluorobenzamide |
| SMILES | Nc1cc(F)ccc1C(=O)NCC1CC2CCC1C2 |
| InChI | InChI=1S/C15H19FN2O/c16-12-3-4-13(14(17)7-12)15(19)18-8-11-6-9-1-2-10(11)5-9/h3-4,7,9-11H,1-2,5-6,8,17H2,(H,18,19) |
| InChIKey | AURADSOGNXCZNW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|