C23H31NO4 — CID 163631470
2-bicyclo[2.2.1]heptanylmethyl 2-[(E)-4-(ethylamino)-2-methylpent-2-enoyl]oxybenzoate (PubChem CID 163631470) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanylmethyl 2-[(E)-4-(ethylamino)-2-methylpent-2-enoyl]oxybenzoate.
| Compound Name | 2-bicyclo[2.2.1]heptanylmethyl 2-[(E)-4-(ethylamino)-2-methylpent-2-enoyl]oxybenzoate |
|---|---|
| PubChem CID | 163631470 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanylmethyl 2-[(E)-4-(ethylamino)-2-methylpent-2-enoyl]oxybenzoate |
| SMILES | CCNC(C)/C=C(\C)C(=O)Oc1ccccc1C(=O)OCC1CC2CCC1C2 |
| InChI | InChI=1S/C23H31NO4/c1-4-24-16(3)11-15(2)22(25)28-21-8-6-5-7-20(21)23(26)27-14-19-13-17-9-10-18(19)12-17/h5-8,11,16-19,24H,4,9-10,12-14H2,1-3H3/b15-11+ |
| InChIKey | HWLJTYYENUVGBY-RVDMUPIBSA-N |
| XLogP | 4.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|