C14H17NO3 — CID 114245708
4-amino-2-(2-bicyclo[2.2.1]heptanyloxy)benzoic acid (PubChem CID 114245708) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 4-amino-2-(2-bicyclo[2.2.1]heptanyloxy)benzoic acid.
| Compound Name | 4-amino-2-(2-bicyclo[2.2.1]heptanyloxy)benzoic acid |
|---|---|
| PubChem CID | 114245708 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-amino-2-(2-bicyclo[2.2.1]heptanyloxy)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(OC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C14H17NO3/c15-10-3-4-11(14(16)17)13(7-10)18-12-6-8-1-2-9(12)5-8/h3-4,7-9,12H,1-2,5-6,15H2,(H,16,17) |
| InChIKey | ZMNGYVQMARKZDD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|