C13H15NO4S — CID 98786067
[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl 5-nitrothiophene-3-carboxylate (PubChem CID 98786067) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl 5-nitrothiophene-3-carboxylate.
| Compound Name | [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl 5-nitrothiophene-3-carboxylate |
|---|---|
| PubChem CID | 98786067 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl 5-nitrothiophene-3-carboxylate |
| SMILES | O=C(OC[C@H]1C[C@H]2CC[C@H]1C2)c1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15NO4S/c15-13(11-5-12(14(16)17)19-7-11)18-6-10-4-8-1-2-9(10)3-8/h5,7-10H,1-4,6H2/t8-,9-,10+/m0/s1 |
| InChIKey | CQRFSZOLLHRUKT-LPEHRKFASA-N |
| XLogP | 3.25 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|