C17H24O5 — CID 78770626
(3-methylcyclohexyl) 2,4,5-trimethoxybenzoate (PubChem CID 78770626) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2,4,5-trimethoxybenzoate.
| Compound Name | (3-methylcyclohexyl) 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 78770626 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (3-methylcyclohexyl) 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OC2CCCC(C)C2)cc1OC |
| InChI | InChI=1S/C17H24O5/c1-11-6-5-7-12(8-11)22-17(18)13-9-15(20-3)16(21-4)10-14(13)19-2/h9-12H,5-8H2,1-4H3 |
| InChIKey | FPSCSUMCGIYMSK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |